C18H18N4O6S — CID 39975470
5-(furan-2-yl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,2-oxazole (PubChem CID 39975470) has the molecular formula C18H18N4O6S and a molecular weight of 418.43 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-(furan-2-yl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 39975470 |
| Molecular Formula | C18H18N4O6S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 5-(furan-2-yl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCN(Cc3cc(-c4ccco4)on3)CC2)cc1 |
| InChI | InChI=1S/C18H18N4O6S/c23-22(24)15-3-5-16(6-4-15)29(25,26)21-9-7-20(8-10-21)13-14-12-18(28-19-14)17-2-1-11-27-17/h1-6,11-12H,7-10,13H2 |
| InChIKey | NDVVFJWEXMMDKQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 122.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|