C11H10ClNO4S — CID 165481100
[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (PubChem CID 165481100) has the molecular formula C11H10ClNO4S and a molecular weight of 287.72 g/mol. Its IUPAC name is [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
| Compound Name | [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 165481100 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
| SMILES | COc1cccc(-c2cc(CS(=O)(=O)Cl)no2)c1 |
| InChI | InChI=1S/C11H10ClNO4S/c1-16-10-4-2-3-8(5-10)11-6-9(13-17-11)7-18(12,14)15/h2-6H,7H2,1H3 |
| InChIKey | RXDMEUPPGSQDBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |