About [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride
[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (PubChem CID 165479251) has the molecular formula C10H7ClFNO3S
and a molecular weight of 275.69 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
Analyze [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
The IUPAC name of [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (CID 165479251) is [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
What is the SMILES notation for [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
The canonical SMILES for [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride is O=S(=O)(Cl)Cc1cc(-c2ccccc2F)on1.
What is the InChIKey of [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
The InChIKey is RNKJNBLEWREQEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClFNO3S/c11-17(14,15)6-7-5-10(16-13-7)8-3-1-2-4-9(8)12/h1-5H,6H2.
What are the key properties of [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride has a molecular weight of 275.69 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-fluorophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride is sourced from PubChem (CID 165479251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).