C27H29ClN2O5 — CID 145197277
methyl 2-[(10S)-5-(4-chlorophenyl)-10-[1-(2-ethoxy-2-oxoethoxy)ethenyl]-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate (PubChem CID 145197277) has the molecular formula C27H29ClN2O5 and a molecular weight of 496.99 g/mol. Its IUPAC name is methyl 2-[(10S)-5-(4-chlorophenyl)-10-[1-(2-ethoxy-2-oxoethoxy)ethenyl]-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate.
| Compound Name | methyl 2-[(10S)-5-(4-chlorophenyl)-10-[1-(2-ethoxy-2-oxoethoxy)ethenyl]-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate |
|---|---|
| PubChem CID | 145197277 |
| Molecular Formula | C27H29ClN2O5 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | methyl 2-[(10S)-5-(4-chlorophenyl)-10-[1-(2-ethoxy-2-oxoethoxy)ethenyl]-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate |
| SMILES | C=C(OCC(=O)OCC)[C@@H]1Cn2c(C)cc3c(-c4ccc(Cl)cc4)c(CC(=O)OC)c(C)c(c32)N1 |
| InChI | InChI=1S/C27H29ClN2O5/c1-6-34-24(32)14-35-17(4)22-13-30-15(2)11-21-25(18-7-9-19(28)10-8-18)20(12-23(31)33-5)16(3)26(29-22)27(21)30/h7-11,22,29H,4,6,12-14H2,1-3,5H3/t22-/m0/s1 |
| InChIKey | VCVFZXRGIGFCMN-QFIPXVFZSA-N |
| XLogP | 5.18 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|