About cyclopentyl(diethoxymethyl)silane;silane;hydrobromide
cyclopentyl(diethoxymethyl)silane;silane;hydrobromide (PubChem CID 158765336) has the molecular formula C10H27BrO2Si2
and a molecular weight of 315.40 g/mol. Its IUPAC name is cyclopentyl(diethoxymethyl)silane;silane;hydrobromide.
Molecular Properties
| Compound Name | cyclopentyl(diethoxymethyl)silane;silane;hydrobromide |
| PubChem CID | 158765336 |
| Molecular Formula | C10H27BrO2Si2 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | cyclopentyl(diethoxymethyl)silane;silane;hydrobromide |
| SMILES | Br.CCOC(OCC)[SiH2]C1CCCC1.[SiH4] |
| InChI | InChI=1S/C10H22O2Si.BrH.H4Si/c1-3-11-10(12-4-2)13-9-7-5-6-8-9;;/h9-10H,3-8,13H2,1-2H3;1H;1H4 |
| InChIKey | YUNYLEHHYCPEJJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl(diethoxymethyl)silane;silane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl(diethoxymethyl)silane;silane;hydrobromide?
The IUPAC name of cyclopentyl(diethoxymethyl)silane;silane;hydrobromide (CID 158765336) is cyclopentyl(diethoxymethyl)silane;silane;hydrobromide.
What is the SMILES notation for cyclopentyl(diethoxymethyl)silane;silane;hydrobromide?
The canonical SMILES for cyclopentyl(diethoxymethyl)silane;silane;hydrobromide is Br.CCOC(OCC)[SiH2]C1CCCC1.[SiH4].
What is the InChIKey of cyclopentyl(diethoxymethyl)silane;silane;hydrobromide?
The InChIKey is YUNYLEHHYCPEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2Si.BrH.H4Si/c1-3-11-10(12-4-2)13-9-7-5-6-8-9;;/h9-10H,3-8,13H2,1-2H3;1H;1H4.
What are the key properties of cyclopentyl(diethoxymethyl)silane;silane;hydrobromide?
cyclopentyl(diethoxymethyl)silane;silane;hydrobromide has a molecular weight of 315.40 g/mol, XLogP of 1.00, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl(diethoxymethyl)silane;silane;hydrobromide is sourced from PubChem (CID 158765336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).