C11H8F3N3O4S — CID 158767432
5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile;trifluoromethanesulfonic acid (PubChem CID 158767432) has the molecular formula C11H8F3N3O4S and a molecular weight of 335.26 g/mol. Its IUPAC name is 5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile;trifluoromethanesulfonic acid.
| Compound Name | 5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 158767432 |
| Molecular Formula | C11H8F3N3O4S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile;trifluoromethanesulfonic acid |
| SMILES | Cn1c(=O)ccc2nc(C#N)ccc21.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H7N3O.CHF3O3S/c1-13-9-4-2-7(6-11)12-8(9)3-5-10(13)14;2-1(3,4)8(5,6)7/h2-5H,1H3;(H,5,6,7) |
| InChIKey | IPKZFRFKVLCHTC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|