C30H27ClO5 — CID 158770939
[2-chloro-4-[4-(2-oxobut-3-enyl)benzoyl]phenyl] acetate;1-(4-methylphenyl)but-3-en-2-one (PubChem CID 158770939) has the molecular formula C30H27ClO5 and a molecular weight of 502.99 g/mol. Its IUPAC name is [2-chloro-4-[4-(2-oxobut-3-enyl)benzoyl]phenyl] acetate;1-(4-methylphenyl)but-3-en-2-one.
| Compound Name | [2-chloro-4-[4-(2-oxobut-3-enyl)benzoyl]phenyl] acetate;1-(4-methylphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 158770939 |
| Molecular Formula | C30H27ClO5 |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [2-chloro-4-[4-(2-oxobut-3-enyl)benzoyl]phenyl] acetate;1-(4-methylphenyl)but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccc(C(=O)c2ccc(OC(C)=O)c(Cl)c2)cc1.C=CC(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C19H15ClO4.C11H12O/c1-3-16(22)10-13-4-6-14(7-5-13)19(23)15-8-9-18(17(20)11-15)24-12(2)21;1-3-11(12)8-10-6-4-9(2)5-7-10/h3-9,11H,1,10H2,2H3;3-7H,1,8H2,2H3 |
| InChIKey | IPVWZVHXRVUOAN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|