C50H38BClF2N8O2 — CID 158772416
2-chloro-4,6-diphenyl-1,3,5-triazine;5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluorobenzonitrile;2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 158772416) has the molecular formula C50H38BClF2N8O2 and a molecular weight of 867.17 g/mol. Its IUPAC name is 2-chloro-4,6-diphenyl-1,3,5-triazine;5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluorobenzonitrile;2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-chloro-4,6-diphenyl-1,3,5-triazine;5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluorobenzonitrile;2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 158772416 |
| Molecular Formula | C50H38BClF2N8O2 |
| Molecular Weight | 867.17 g/mol |
| Exact Mass | 866.29 |
| IUPAC Name | 2-chloro-4,6-diphenyl-1,3,5-triazine;5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-fluorobenzonitrile;2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2ccc(F)c(C#N)c2)OC1(C)C.Clc1nc(-c2ccccc2)nc(-c2ccccc2)n1.N#Cc1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1F |
| InChI | InChI=1S/C22H13FN4.C15H10ClN3.C13H15BFNO2/c23-19-12-11-17(13-18(19)14-24)22-26-20(15-7-3-1-4-8-15)25-21(27-22)16-9-5-2-6-10-16;16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12;1-12(2)13(3,4)18-14(17-12)10-5-6-11(15)9(7-10)8-16/h1-13H;1-10H;5-7H,1-4H3 |
| InChIKey | IQARQYORKMSPRQ-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 143.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.17 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|