C39H21BCl2F12N6O2 — CID 158408626
2,4-bis[2-fluoro-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine;2,4-dichloro-6-phenyl-1,3,5-triazine;[2-fluoro-5-(trifluoromethyl)phenyl]boronic acid (PubChem CID 158408626) has the molecular formula C39H21BCl2F12N6O2 and a molecular weight of 915.33 g/mol. Its IUPAC name is 2,4-bis[2-fluoro-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine;2,4-dichloro-6-phenyl-1,3,5-triazine;[2-fluoro-5-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | 2,4-bis[2-fluoro-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine;2,4-dichloro-6-phenyl-1,3,5-triazine;[2-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 158408626 |
| Molecular Formula | C39H21BCl2F12N6O2 |
| Molecular Weight | 915.33 g/mol |
| Exact Mass | 914.10 |
| IUPAC Name | 2,4-bis[2-fluoro-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine;2,4-dichloro-6-phenyl-1,3,5-triazine;[2-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
| SMILES | Clc1nc(Cl)nc(-c2ccccc2)n1.Fc1ccc(C(F)(F)F)cc1-c1nc(-c2ccccc2)nc(-c2cc(C(F)(F)F)ccc2F)n1.OB(O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C23H11F8N3.C9H5Cl2N3.C7H5BF4O2/c24-17-8-6-13(22(26,27)28)10-15(17)20-32-19(12-4-2-1-3-5-12)33-21(34-20)16-11-14(23(29,30)31)7-9-18(16)25;10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-11H;1-5H;1-3,13-14H |
| InChIKey | GZAAJQYGXFSODC-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.33 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|