About 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol
4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol (PubChem CID 158773745) has the molecular formula C16H31N3O
and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol.
Molecular Properties
| Compound Name | 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol |
| PubChem CID | 158773745 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol |
| SMILES | CCC(C)Nc1ccc(N(N)C(C)CC)cc1.CCO |
| InChI | InChI=1S/C14H25N3.C2H6O/c1-5-11(3)16-13-7-9-14(10-8-13)17(15)12(4)6-2;1-2-3/h7-12,16H,5-6,15H2,1-4H3;3H,2H2,1H3 |
| InChIKey | IQFBCAPLZPJZFW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol?
The IUPAC name of 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol (CID 158773745) is 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol.
What is the SMILES notation for 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol?
The canonical SMILES for 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol is CCC(C)Nc1ccc(N(N)C(C)CC)cc1.CCO.
What is the InChIKey of 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol?
The InChIKey is IQFBCAPLZPJZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3.C2H6O/c1-5-11(3)16-13-7-9-14(10-8-13)17(15)12(4)6-2;1-2-3/h7-12,16H,5-6,15H2,1-4H3;3H,2H2,1H3.
What are the key properties of 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol?
4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol has a molecular weight of 281.44 g/mol, XLogP of 3.37, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[amino(butan-2-yl)amino]-N-butan-2-ylaniline;ethanol is sourced from PubChem (CID 158773745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).