About triethylalumane;trioctylalumane
triethylalumane;trioctylalumane (PubChem CID 158774524) has the molecular formula C30H66Al2
and a molecular weight of 480.82 g/mol. Its IUPAC name is triethylalumane;trioctylalumane.
Molecular Properties
| Compound Name | triethylalumane;trioctylalumane |
| PubChem CID | 158774524 |
| Molecular Formula | C30H66Al2 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.48 |
| IUPAC Name | triethylalumane;trioctylalumane |
| SMILES | CCCCCCCC[Al](CCCCCCCC)CCCCCCCC.CC[Al](CC)CC |
| InChI | InChI=1S/3C8H17.3C2H5.2Al/c3*1-3-5-7-8-6-4-2;3*1-2;;/h3*1,3-8H2,2H3;3*1H2,2H3;; |
| InChIKey | IQHPGXFMZXPOFH-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze triethylalumane;trioctylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylalumane;trioctylalumane?
The IUPAC name of triethylalumane;trioctylalumane (CID 158774524) is triethylalumane;trioctylalumane.
What is the SMILES notation for triethylalumane;trioctylalumane?
The canonical SMILES for triethylalumane;trioctylalumane is CCCCCCCC[Al](CCCCCCCC)CCCCCCCC.CC[Al](CC)CC.
What is the InChIKey of triethylalumane;trioctylalumane?
The InChIKey is IQHPGXFMZXPOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H17.3C2H5.2Al/c3*1-3-5-7-8-6-4-2;3*1-2;;/h3*1,3-8H2,2H3;3*1H2,2H3;;.
What are the key properties of triethylalumane;trioctylalumane?
triethylalumane;trioctylalumane has a molecular weight of 480.82 g/mol, XLogP of 12.10, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylalumane;trioctylalumane is sourced from PubChem (CID 158774524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).