About N,N-dioctyloctan-1-amine;triethylalumane
N,N-dioctyloctan-1-amine;triethylalumane (PubChem CID 172737548) has the molecular formula C30H66AlN
and a molecular weight of 467.85 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;triethylalumane.
Molecular Properties
| Compound Name | N,N-dioctyloctan-1-amine;triethylalumane |
| PubChem CID | 172737548 |
| Molecular Formula | C30H66AlN |
| Molecular Weight | 467.85 g/mol |
| Exact Mass | 467.50 |
| IUPAC Name | N,N-dioctyloctan-1-amine;triethylalumane |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.CC[Al](CC)CC |
| InChI | InChI=1S/C24H51N.3C2H5.Al/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;3*1-2;/h4-24H2,1-3H3;3*1H2,2H3; |
| InChIKey | IQLNOGZDTLKXRM-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.85 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dioctyloctan-1-amine;triethylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dioctyloctan-1-amine;triethylalumane?
The IUPAC name of N,N-dioctyloctan-1-amine;triethylalumane (CID 172737548) is N,N-dioctyloctan-1-amine;triethylalumane.
What is the SMILES notation for N,N-dioctyloctan-1-amine;triethylalumane?
The canonical SMILES for N,N-dioctyloctan-1-amine;triethylalumane is CCCCCCCCN(CCCCCCCC)CCCCCCCC.CC[Al](CC)CC.
What is the InChIKey of N,N-dioctyloctan-1-amine;triethylalumane?
The InChIKey is IQLNOGZDTLKXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51N.3C2H5.Al/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;3*1-2;/h4-24H2,1-3H3;3*1H2,2H3;.
What are the key properties of N,N-dioctyloctan-1-amine;triethylalumane?
N,N-dioctyloctan-1-amine;triethylalumane has a molecular weight of 467.85 g/mol, XLogP of 10.91, 24 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dioctyloctan-1-amine;triethylalumane is sourced from PubChem (CID 172737548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).