C18H13ClF5N3O — CID 158779533
N-[chloro(difluoro)methyl]-1-methylpyrazole-4-carboxamide;1,2-difluoro-4-(2-fluorophenyl)benzene (PubChem CID 158779533) has the molecular formula C18H13ClF5N3O and a molecular weight of 417.77 g/mol. Its IUPAC name is N-[chloro(difluoro)methyl]-1-methylpyrazole-4-carboxamide;1,2-difluoro-4-(2-fluorophenyl)benzene.
| Compound Name | N-[chloro(difluoro)methyl]-1-methylpyrazole-4-carboxamide;1,2-difluoro-4-(2-fluorophenyl)benzene |
|---|---|
| PubChem CID | 158779533 |
| Molecular Formula | C18H13ClF5N3O |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N-[chloro(difluoro)methyl]-1-methylpyrazole-4-carboxamide;1,2-difluoro-4-(2-fluorophenyl)benzene |
| SMILES | Cn1cc(C(=O)NC(F)(F)Cl)cn1.Fc1ccc(-c2ccccc2F)cc1F |
| InChI | InChI=1S/C12H7F3.C6H6ClF2N3O/c13-10-4-2-1-3-9(10)8-5-6-11(14)12(15)7-8;1-12-3-4(2-10-12)5(13)11-6(7,8)9/h1-7H;2-3H,1H3,(H,11,13) |
| InChIKey | IQWWWDLDWFQVIZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|