About chloroethane;3-propylpiperidine-3-carboxylic acid
chloroethane;3-propylpiperidine-3-carboxylic acid (PubChem CID 158782961) has the molecular formula C11H22ClNO2
and a molecular weight of 235.75 g/mol. Its IUPAC name is chloroethane;3-propylpiperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | chloroethane;3-propylpiperidine-3-carboxylic acid |
| PubChem CID | 158782961 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | chloroethane;3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCNC1.CCCl |
| InChI | InChI=1S/C9H17NO2.C2H5Cl/c1-2-4-9(8(11)12)5-3-6-10-7-9;1-2-3/h10H,2-7H2,1H3,(H,11,12);2H2,1H3 |
| InChIKey | IRHWYQJPEUHBAY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;3-propylpiperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;3-propylpiperidine-3-carboxylic acid?
The IUPAC name of chloroethane;3-propylpiperidine-3-carboxylic acid (CID 158782961) is chloroethane;3-propylpiperidine-3-carboxylic acid.
What is the SMILES notation for chloroethane;3-propylpiperidine-3-carboxylic acid?
The canonical SMILES for chloroethane;3-propylpiperidine-3-carboxylic acid is CCCC1(C(=O)O)CCCNC1.CCCl.
What is the InChIKey of chloroethane;3-propylpiperidine-3-carboxylic acid?
The InChIKey is IRHWYQJPEUHBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C2H5Cl/c1-2-4-9(8(11)12)5-3-6-10-7-9;1-2-3/h10H,2-7H2,1H3,(H,11,12);2H2,1H3.
What are the key properties of chloroethane;3-propylpiperidine-3-carboxylic acid?
chloroethane;3-propylpiperidine-3-carboxylic acid has a molecular weight of 235.75 g/mol, XLogP of 2.49, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;3-propylpiperidine-3-carboxylic acid is sourced from PubChem (CID 158782961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).