C65H37N9 — CID 158785105
3,5-bis[2-(3-cyanophenyl)-7-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzonitrile (PubChem CID 158785105) has the molecular formula C65H37N9 and a molecular weight of 944.07 g/mol. Its IUPAC name is 3,5-bis[2-(3-cyanophenyl)-7-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzonitrile.
| Compound Name | 3,5-bis[2-(3-cyanophenyl)-7-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 158785105 |
| Molecular Formula | C65H37N9 |
| Molecular Weight | 944.07 g/mol |
| Exact Mass | 943.32 |
| IUPAC Name | 3,5-bis[2-(3-cyanophenyl)-7-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c4ccc(-c5cccc(C#N)c5)cc4n(-c4cc(C#N)cc(-n5c6cc(-c7cccc(C#N)c7)ccc6c6ccc(-c7cccc([N+]#[C-])c7)cc65)c4-c4nc(C)cc(C)n4)c3c2)c1 |
| InChI | InChI=1S/C65H37N9/c1-39-25-40(2)72-65(71-39)64-62(73-58-32-48(44-11-5-9-41(26-44)36-66)17-21-54(58)56-23-19-50(34-60(56)73)46-13-7-15-52(30-46)69-3)28-43(38-68)29-63(64)74-59-33-49(45-12-6-10-42(27-45)37-67)18-22-55(59)57-24-20-51(35-61(57)74)47-14-8-16-53(31-47)70-4/h5-35H,1-2H3 |
| InChIKey | TXMMCGGCDBGFJE-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 115.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.07 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|