About 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate
1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate (PubChem CID 158792058) has the molecular formula C15H16N2O6
and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate |
| PubChem CID | 158792058 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)Nc1ccc2c(c1)NC(=O)C2)C(=O)OC |
| InChI | InChI=1S/C15H16N2O6/c1-3-23-15(21)12(14(20)22-2)13(19)16-9-5-4-8-6-11(18)17-10(8)7-9/h4-5,7,12H,3,6H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | BFNRAPMXLCXECJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate?
The IUPAC name of 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate (CID 158792058) is 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate?
The canonical SMILES for 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate is CCOC(=O)C(C(=O)Nc1ccc2c(c1)NC(=O)C2)C(=O)OC.
What is the InChIKey of 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate?
The InChIKey is BFNRAPMXLCXECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O6/c1-3-23-15(21)12(14(20)22-2)13(19)16-9-5-4-8-6-11(18)17-10(8)7-9/h4-5,7,12H,3,6H2,1-2H3,(H,16,19)(H,17,18).
What are the key properties of 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate?
1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate has a molecular weight of 320.30 g/mol, XLogP of 0.47, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-methyl 2-[(2-oxo-1,3-dihydroindol-6-yl)carbamoyl]propanedioate is sourced from PubChem (CID 158792058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).