C9H15F2NO2 — CID 158792156
7-amino-9,9-difluoro-6-hydroxynon-1-en-5-one (PubChem CID 158792156) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is 7-amino-9,9-difluoro-6-hydroxynon-1-en-5-one.
| Compound Name | 7-amino-9,9-difluoro-6-hydroxynon-1-en-5-one |
|---|---|
| PubChem CID | 158792156 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 7-amino-9,9-difluoro-6-hydroxynon-1-en-5-one |
| SMILES | C=CCCC(=O)C(O)C(N)CC(F)F |
| InChI | InChI=1S/C9H15F2NO2/c1-2-3-4-7(13)9(14)6(12)5-8(10)11/h2,6,8-9,14H,1,3-5,12H2 |
| InChIKey | IMSWECCOYPMXJT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|