C15H25N3O7S — CID 158794002
(2S,6S)-8-amino-6-[[(3S)-3-amino-4-hydroxy-2-oxobutyl]carbamothioyl]-2-(1-hydroxyethyl)-4,8-dioxooctanoic acid (PubChem CID 158794002) has the molecular formula C15H25N3O7S and a molecular weight of 391.45 g/mol. Its IUPAC name is (2S,6S)-8-amino-6-[[(3S)-3-amino-4-hydroxy-2-oxobutyl]carbamothioyl]-2-(1-hydroxyethyl)-4,8-dioxooctanoic acid.
| Compound Name | (2S,6S)-8-amino-6-[[(3S)-3-amino-4-hydroxy-2-oxobutyl]carbamothioyl]-2-(1-hydroxyethyl)-4,8-dioxooctanoic acid |
|---|---|
| PubChem CID | 158794002 |
| Molecular Formula | C15H25N3O7S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S,6S)-8-amino-6-[[(3S)-3-amino-4-hydroxy-2-oxobutyl]carbamothioyl]-2-(1-hydroxyethyl)-4,8-dioxooctanoic acid |
| SMILES | CC(O)[C@H](CC(=O)C[C@@H](CC(N)=O)C(=S)NCC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C15H25N3O7S/c1-7(20)10(15(24)25)4-9(21)2-8(3-13(17)23)14(26)18-5-12(22)11(16)6-19/h7-8,10-11,19-20H,2-6,16H2,1H3,(H2,17,23)(H,18,26)(H,24,25)/t7?,8-,10-,11-/m0/s1 |
| InChIKey | ISQFFIGHJWEGAN-QHSNHLGFSA-N |
| XLogP | -2.29 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|