C5H11N3O3 — CID 88513048
(3S)-3-amino-5-(hydroxyamino)-4-oxopentanamide (PubChem CID 88513048) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is (3S)-3-amino-5-(hydroxyamino)-4-oxopentanamide.
| Compound Name | (3S)-3-amino-5-(hydroxyamino)-4-oxopentanamide |
|---|---|
| PubChem CID | 88513048 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (3S)-3-amino-5-(hydroxyamino)-4-oxopentanamide |
| SMILES | NC(=O)C[C@H](N)C(=O)CNO |
| InChI | InChI=1S/C5H11N3O3/c6-3(1-5(7)10)4(9)2-8-11/h3,8,11H,1-2,6H2,(H2,7,10)/t3-/m0/s1 |
| InChIKey | RDMOUDMUUOUJLL-VKHMYHEASA-N |
| XLogP | -2.26 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|