About phenol;4-(phenoxymethyl)chromen-2-one
phenol;4-(phenoxymethyl)chromen-2-one (PubChem CID 158794663) has the molecular formula C22H18O4
and a molecular weight of 346.38 g/mol. Its IUPAC name is phenol;4-(phenoxymethyl)chromen-2-one.
Molecular Properties
| Compound Name | phenol;4-(phenoxymethyl)chromen-2-one |
| PubChem CID | 158794663 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | phenol;4-(phenoxymethyl)chromen-2-one |
| SMILES | O=c1cc(COc2ccccc2)c2ccccc2o1.Oc1ccccc1 |
| InChI | InChI=1S/C16H12O3.C6H6O/c17-16-10-12(11-18-13-6-2-1-3-7-13)14-8-4-5-9-15(14)19-16;7-6-4-2-1-3-5-6/h1-10H,11H2;1-5,7H |
| InChIKey | ISSIFOKBKDBZBT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze phenol;4-(phenoxymethyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;4-(phenoxymethyl)chromen-2-one?
The IUPAC name of phenol;4-(phenoxymethyl)chromen-2-one (CID 158794663) is phenol;4-(phenoxymethyl)chromen-2-one.
What is the SMILES notation for phenol;4-(phenoxymethyl)chromen-2-one?
The canonical SMILES for phenol;4-(phenoxymethyl)chromen-2-one is O=c1cc(COc2ccccc2)c2ccccc2o1.Oc1ccccc1.
What is the InChIKey of phenol;4-(phenoxymethyl)chromen-2-one?
The InChIKey is ISSIFOKBKDBZBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O3.C6H6O/c17-16-10-12(11-18-13-6-2-1-3-7-13)14-8-4-5-9-15(14)19-16;7-6-4-2-1-3-5-6/h1-10H,11H2;1-5,7H.
What are the key properties of phenol;4-(phenoxymethyl)chromen-2-one?
phenol;4-(phenoxymethyl)chromen-2-one has a molecular weight of 346.38 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;4-(phenoxymethyl)chromen-2-one is sourced from PubChem (CID 158794663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).