C23H21N3O — CID 158795571
5-[4-(3H-benzimidazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one (PubChem CID 158795571) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-[4-(3H-benzimidazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one.
| Compound Name | 5-[4-(3H-benzimidazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one |
|---|---|
| PubChem CID | 158795571 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 5-[4-(3H-benzimidazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one |
| SMILES | O=C(CCCc1ccc(-c2ccc3nc[nH]c3c2)cc1)Cc1cccnc1 |
| InChI | InChI=1S/C23H21N3O/c27-21(13-18-4-2-12-24-15-18)5-1-3-17-6-8-19(9-7-17)20-10-11-22-23(14-20)26-16-25-22/h2,4,6-12,14-16H,1,3,5,13H2,(H,25,26) |
| InChIKey | PXGOYJFTKPLBPI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |