C25H25N3O — CID 158795578
5-[4-(1,3-dimethylindazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one (PubChem CID 158795578) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 5-[4-(1,3-dimethylindazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one.
| Compound Name | 5-[4-(1,3-dimethylindazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one |
|---|---|
| PubChem CID | 158795578 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 5-[4-(1,3-dimethylindazol-5-yl)phenyl]-1-pyridin-3-ylpentan-2-one |
| SMILES | Cc1nn(C)c2ccc(-c3ccc(CCCC(=O)Cc4cccnc4)cc3)cc12 |
| InChI | InChI=1S/C25H25N3O/c1-18-24-16-22(12-13-25(24)28(2)27-18)21-10-8-19(9-11-21)5-3-7-23(29)15-20-6-4-14-26-17-20/h4,6,8-14,16-17H,3,5,7,15H2,1-2H3 |
| InChIKey | VRZQUZILQCSEBQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |