C28H25ClF3NO5 — CID 158795618
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(2,3-dimethylcyclopropyl)-2-oxobutyl]benzoic acid (PubChem CID 158795618) has the molecular formula C28H25ClF3NO5 and a molecular weight of 547.96 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(2,3-dimethylcyclopropyl)-2-oxobutyl]benzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(2,3-dimethylcyclopropyl)-2-oxobutyl]benzoic acid |
|---|---|
| PubChem CID | 158795618 |
| Molecular Formula | C28H25ClF3NO5 |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(2,3-dimethylcyclopropyl)-2-oxobutyl]benzoic acid |
| SMILES | CC1C(C)C1CC(C(=O)Cc1ccc(C(=O)O)cc1)c1ccc(-c2c(OC(F)F)ccc(Cl)c2F)c[n+]1[O-] |
| InChI | InChI=1S/C28H25ClF3NO5/c1-14-15(2)19(14)12-20(23(34)11-16-3-5-17(6-4-16)27(35)36)22-9-7-18(13-33(22)37)25-24(38-28(31)32)10-8-21(29)26(25)30/h3-10,13-15,19-20,28H,11-12H2,1-2H3,(H,35,36) |
| InChIKey | ISVCCFGERPXYEZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|