C29H33F2N7O3 — CID 158796825
methyl N-[(3R,4S,5S)-3-amino-1-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]carbamate (PubChem CID 158796825) has the molecular formula C29H33F2N7O3 and a molecular weight of 565.63 g/mol. Its IUPAC name is methyl N-[(3R,4S,5S)-3-amino-1-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]carbamate.
| Compound Name | methyl N-[(3R,4S,5S)-3-amino-1-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 158796825 |
| Molecular Formula | C29H33F2N7O3 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | methyl N-[(3R,4S,5S)-3-amino-1-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]carbamate |
| SMILES | CCOCc1cc(F)c(-c2ccc3cnc(Cc4cnccc4N4C[C@@H](N)[C@@H](NC(=O)OC)[C@@H](C)C4)n3n2)c(F)c1 |
| InChI | InChI=1S/C29H33F2N7O3/c1-4-41-16-18-9-21(30)27(22(31)10-18)24-6-5-20-13-34-26(38(20)36-24)11-19-12-33-8-7-25(19)37-14-17(2)28(23(32)15-37)35-29(39)40-3/h5-10,12-13,17,23,28H,4,11,14-16,32H2,1-3H3,(H,35,39)/t17-,23+,28-/m0/s1 |
| InChIKey | ISYRIWXUVNBOHC-UJDKCDIISA-N |
| XLogP | 3.70 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |