C32H35F2N7O2 — CID 159954041
3-[(3R,4S,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(1-hydroxycyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]oxypropanenitrile (PubChem CID 159954041) has the molecular formula C32H35F2N7O2 and a molecular weight of 587.68 g/mol. Its IUPAC name is 3-[(3R,4S,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(1-hydroxycyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]oxypropanenitrile.
| Compound Name | 3-[(3R,4S,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(1-hydroxycyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]oxypropanenitrile |
|---|---|
| PubChem CID | 159954041 |
| Molecular Formula | C32H35F2N7O2 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 3-[(3R,4S,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(1-hydroxycyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-5-methylpiperidin-4-yl]oxypropanenitrile |
| SMILES | C[C@H]1CN(c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C5(O)CCCC5)cc4F)nn23)C[C@@H](N)[C@H]1OCCC#N |
| InChI | InChI=1S/C32H35F2N7O2/c1-20-18-40(19-26(36)31(20)43-12-4-10-35)28-7-11-37-16-21(28)13-29-38-17-23-5-6-27(39-41(23)29)30-24(33)14-22(15-25(30)34)32(42)8-2-3-9-32/h5-7,11,14-17,20,26,31,42H,2-4,8-9,12-13,18-19,36H2,1H3/t20-,26+,31-/m0/s1 |
| InChIKey | OCMGIBGZAUURMP-VCTGMTIGSA-N |
| XLogP | 4.50 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|