C32H33F2N7O — CID 158354135
2-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]-2-methylpropanenitrile (PubChem CID 158354135) has the molecular formula C32H33F2N7O and a molecular weight of 569.66 g/mol. Its IUPAC name is 2-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 158354135 |
| Molecular Formula | C32H33F2N7O |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 2-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]-2-methylpropanenitrile |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C(C)(C)C#N)cc4F)nn23)C[C@@H](N)[C@H]1OCCC#N |
| InChI | InChI=1S/C32H33F2N7O/c1-19-11-20(12-27(37)31(19)42-10-4-8-35)24-7-9-38-16-21(24)13-29-39-17-23-5-6-28(40-41(23)29)30-25(33)14-22(15-26(30)34)32(2,3)18-36/h5-7,9,14-17,19-20,27,31H,4,10-13,37H2,1-3H3/t19-,20+,27+,31-/m0/s1 |
| InChIKey | GSRCRUAGBTYVRW-WZGQREQISA-N |
| XLogP | 5.60 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|