C30H33F2N5O2 — CID 157389078
1-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclobutan-1-ol (PubChem CID 157389078) has the molecular formula C30H33F2N5O2 and a molecular weight of 533.62 g/mol. Its IUPAC name is 1-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclobutan-1-ol.
| Compound Name | 1-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 157389078 |
| Molecular Formula | C30H33F2N5O2 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 1-[4-[7-[[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclobutan-1-ol |
| SMILES | CO[C@@H]1[C@H](N)C[C@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C5(O)CCC5)cc4F)nn23)C[C@@H]1C |
| InChI | InChI=1S/C30H33F2N5O2/c1-17-10-18(11-25(33)29(17)39-2)22-6-9-34-15-19(22)12-27-35-16-21-4-5-26(36-37(21)27)28-23(31)13-20(14-24(28)32)30(38)7-3-8-30/h4-6,9,13-18,25,29,38H,3,7-8,10-12,33H2,1-2H3/t17-,18+,25+,29-/m0/s1 |
| InChIKey | BLTZEMQJKRWEPA-JSZKITHASA-N |
| XLogP | 4.89 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |