C31H34F3N5O3S — CID 148829845
(1R,2S,3S,5R)-5-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine (PubChem CID 148829845) has the molecular formula C31H34F3N5O3S and a molecular weight of 613.71 g/mol. Its IUPAC name is (1R,2S,3S,5R)-5-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine.
| Compound Name | (1R,2S,3S,5R)-5-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 148829845 |
| Molecular Formula | C31H34F3N5O3S |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | (1R,2S,3S,5R)-5-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C5(F)CCOCC5)cc4F)nn23)C[C@@H](N)[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C31H34F3N5O3S/c1-18-11-19(12-26(35)30(18)43(2,40)41)23-5-8-36-16-20(23)13-28-37-17-22-3-4-27(38-39(22)28)29-24(32)14-21(15-25(29)33)31(34)6-9-42-10-7-31/h3-5,8,14-19,26,30H,6-7,9-13,35H2,1-2H3/t18-,19+,26+,30-/m0/s1 |
| InChIKey | OTLONLBTXGXQNJ-ZUCHJQTPSA-N |
| XLogP | 4.89 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |