C31H34F2N6O3 — CID 158286667
N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]acetamide (PubChem CID 158286667) has the molecular formula C31H34F2N6O3 and a molecular weight of 576.65 g/mol. Its IUPAC name is N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]acetamide.
| Compound Name | N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 158286667 |
| Molecular Formula | C31H34F2N6O3 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexyl]acetamide |
| SMILES | COC1(c2cc(F)c(-c3ccc4cnc(Cc5cnccc5[C@H]5C[C@@H](N)[C@@H](NC(C)=O)[C@@H](C)C5)n4n3)c(F)c2)COC1 |
| InChI | InChI=1S/C31H34F2N6O3/c1-17-8-19(9-26(34)30(17)37-18(2)40)23-6-7-35-13-20(23)10-28-36-14-22-4-5-27(38-39(22)28)29-24(32)11-21(12-25(29)33)31(41-3)15-42-16-31/h4-7,11-14,17,19,26,30H,8-10,15-16,34H2,1-3H3,(H,37,40)/t17-,19+,26+,30-/m0/s1 |
| InChIKey | GKVZFIIVAHDQTG-YDPGFCLTSA-N |
| XLogP | 3.88 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |