C28H29F2N5O2 — CID 158198551
(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol (PubChem CID 158198551) has the molecular formula C28H29F2N5O2 and a molecular weight of 505.57 g/mol. Its IUPAC name is (1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol.
| Compound Name | (1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 158198551 |
| Molecular Formula | C28H29F2N5O2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxetan-3-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C5COC5)cc4F)nn23)C[C@@H](N)[C@H]1O |
| InChI | InChI=1S/C28H29F2N5O2/c1-15-6-17(9-24(31)28(15)36)21-4-5-32-11-18(21)10-26-33-12-20-2-3-25(34-35(20)26)27-22(29)7-16(8-23(27)30)19-13-37-14-19/h2-5,7-8,11-12,15,17,19,24,28,36H,6,9-10,13-14,31H2,1H3/t15-,17+,24+,28-/m0/s1 |
| InChIKey | GAQKJAQXAGPIAW-XJVRTJQLSA-N |
| XLogP | 3.98 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |