C30H32F3N5O — CID 158675171
(1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(1-fluorocyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol (PubChem CID 158675171) has the molecular formula C30H32F3N5O and a molecular weight of 535.61 g/mol. Its IUPAC name is (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(1-fluorocyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol.
| Compound Name | (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(1-fluorocyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 158675171 |
| Molecular Formula | C30H32F3N5O |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(1-fluorocyclopentyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-6-methylcyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C5(F)CCCC5)cc4F)nn23)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C30H32F3N5O/c1-17-10-18(11-25(34)29(17)39)22-6-9-35-15-19(22)12-27-36-16-21-4-5-26(37-38(21)27)28-23(31)13-20(14-24(28)32)30(33)7-2-3-8-30/h4-6,9,13-18,25,29,39H,2-3,7-8,10-12,34H2,1H3/t17-,18+,25+,29+/m0/s1 |
| InChIKey | IEKREKMCSYVJOS-OUXIUSEWSA-N |
| XLogP | 5.60 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |