C31H35F2N5O2 — CID 157202049
1-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclopentan-1-ol (PubChem CID 157202049) has the molecular formula C31H35F2N5O2 and a molecular weight of 547.65 g/mol. Its IUPAC name is 1-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclopentan-1-ol.
| Compound Name | 1-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 157202049 |
| Molecular Formula | C31H35F2N5O2 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 1-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]methyl]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]cyclopentan-1-ol |
| SMILES | CO[C@H]1[C@H](N)C[C@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(C5(O)CCCC5)cc4F)nn23)C[C@@H]1C |
| InChI | InChI=1S/C31H35F2N5O2/c1-18-11-19(12-26(34)30(18)40-2)23-7-10-35-16-20(23)13-28-36-17-22-5-6-27(37-38(22)28)29-24(32)14-21(15-25(29)33)31(39)8-3-4-9-31/h5-7,10,14-19,26,30,39H,3-4,8-9,11-13,34H2,1-2H3/t18-,19+,26+,30+/m0/s1 |
| InChIKey | AQXIGDLWNANADV-PLMUEWLLSA-N |
| XLogP | 5.28 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |