C29H33F2N5O3S — CID 159406959
(1R,2R,3S,5R)-5-[3-[[2-(2,6-difluoro-4-propan-2-yloxyphenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine (PubChem CID 159406959) has the molecular formula C29H33F2N5O3S and a molecular weight of 569.68 g/mol. Its IUPAC name is (1R,2R,3S,5R)-5-[3-[[2-(2,6-difluoro-4-propan-2-yloxyphenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine.
| Compound Name | (1R,2R,3S,5R)-5-[3-[[2-(2,6-difluoro-4-propan-2-yloxyphenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 159406959 |
| Molecular Formula | C29H33F2N5O3S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | (1R,2R,3S,5R)-5-[3-[[2-(2,6-difluoro-4-propan-2-yloxyphenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-methylsulfonylcyclohexan-1-amine |
| SMILES | CC(C)Oc1cc(F)c(-c2ccc3cnc(Cc4cnccc4[C@H]4C[C@@H](N)[C@H](S(C)(=O)=O)[C@@H](C)C4)n3n2)c(F)c1 |
| InChI | InChI=1S/C29H33F2N5O3S/c1-16(2)39-21-12-23(30)28(24(31)13-21)26-6-5-20-15-34-27(36(20)35-26)11-19-14-33-8-7-22(19)18-9-17(3)29(25(32)10-18)40(4,37)38/h5-8,12-18,25,29H,9-11,32H2,1-4H3/t17-,18+,25+,29+/m0/s1 |
| InChIKey | LOBTUCILAJULAT-OUXIUSEWSA-N |
| XLogP | 4.70 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |