C28H31F2N5O3S — CID 160910222
(1R,2S,3S,5R)-5-[3-[[2-(2,6-difluorophenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-(2-methylsulfonylethoxy)cyclohexan-1-amine (PubChem CID 160910222) has the molecular formula C28H31F2N5O3S and a molecular weight of 555.65 g/mol. Its IUPAC name is (1R,2S,3S,5R)-5-[3-[[2-(2,6-difluorophenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-(2-methylsulfonylethoxy)cyclohexan-1-amine.
| Compound Name | (1R,2S,3S,5R)-5-[3-[[2-(2,6-difluorophenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-(2-methylsulfonylethoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 160910222 |
| Molecular Formula | C28H31F2N5O3S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (1R,2S,3S,5R)-5-[3-[[2-(2,6-difluorophenyl)imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-3-methyl-2-(2-methylsulfonylethoxy)cyclohexan-1-amine |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cccc4F)nn23)C[C@@H](N)[C@H]1OCCS(C)(=O)=O |
| InChI | InChI=1S/C28H31F2N5O3S/c1-17-12-18(13-24(31)28(17)38-10-11-39(2,36)37)21-8-9-32-15-19(21)14-26-33-16-20-6-7-25(34-35(20)26)27-22(29)4-3-5-23(27)30/h3-9,15-18,24,28H,10-14,31H2,1-2H3/t17-,18+,24+,28-/m0/s1 |
| InChIKey | SQRHGFLZGVWQLM-SEHDDTEPSA-N |
| XLogP | 3.93 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |