C30H38F3N3O3S — CID 158799796
1-ethyl-5-(furan-3-yl)-7-(trifluoromethyl)benzimidazole-2-carboxylic acid;N-(thiophen-2-ylmethyl)decan-1-amine (PubChem CID 158799796) has the molecular formula C30H38F3N3O3S and a molecular weight of 577.71 g/mol. Its IUPAC name is 1-ethyl-5-(furan-3-yl)-7-(trifluoromethyl)benzimidazole-2-carboxylic acid;N-(thiophen-2-ylmethyl)decan-1-amine.
| Compound Name | 1-ethyl-5-(furan-3-yl)-7-(trifluoromethyl)benzimidazole-2-carboxylic acid;N-(thiophen-2-ylmethyl)decan-1-amine |
|---|---|
| PubChem CID | 158799796 |
| Molecular Formula | C30H38F3N3O3S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 1-ethyl-5-(furan-3-yl)-7-(trifluoromethyl)benzimidazole-2-carboxylic acid;N-(thiophen-2-ylmethyl)decan-1-amine |
| SMILES | CCCCCCCCCCNCc1cccs1.CCn1c(C(=O)O)nc2cc(-c3ccoc3)cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C15H11F3N2O3.C15H27NS/c1-2-20-12-10(15(16,17)18)5-9(8-3-4-23-7-8)6-11(12)19-13(20)14(21)22;1-2-3-4-5-6-7-8-9-12-16-14-15-11-10-13-17-15/h3-7H,2H2,1H3,(H,21,22);10-11,13,16H,2-9,12,14H2,1H3 |
| InChIKey | ITIJTTLQEWNRLQ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|