C28H33ClF3N3O4 — CID 160653860
3-chloro-6-(furan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid;N-(furan-3-ylmethyl)decan-1-amine (PubChem CID 160653860) has the molecular formula C28H33ClF3N3O4 and a molecular weight of 568.04 g/mol. Its IUPAC name is 3-chloro-6-(furan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid;N-(furan-3-ylmethyl)decan-1-amine.
| Compound Name | 3-chloro-6-(furan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid;N-(furan-3-ylmethyl)decan-1-amine |
|---|---|
| PubChem CID | 160653860 |
| Molecular Formula | C28H33ClF3N3O4 |
| Molecular Weight | 568.04 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 3-chloro-6-(furan-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid;N-(furan-3-ylmethyl)decan-1-amine |
| SMILES | CCCCCCCCCCNCc1ccoc1.O=C(O)c1nc2c(C(F)(F)F)cc(-c3ccco3)cn2c1Cl |
| InChI | InChI=1S/C15H27NO.C13H6ClF3N2O3/c1-2-3-4-5-6-7-8-9-11-16-13-15-10-12-17-14-15;14-10-9(12(20)21)18-11-7(13(15,16)17)4-6(5-19(10)11)8-2-1-3-22-8/h10,12,14,16H,2-9,11,13H2,1H3;1-5H,(H,20,21) |
| InChIKey | RKUBJCBJWBSZPS-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.04 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|