C90H66N12O12+6 — CID 158800692
(2E)-1-(1-methylpyridin-1-ium-3-carbonyl)-2-[1-(1-methylpyridin-1-ium-3-carbonyl)-3-oxoindol-2-ylidene]indol-3-one (PubChem CID 158800692) has the molecular formula C90H66N12O12+6 and a molecular weight of 1507.59 g/mol. Its IUPAC name is (2E)-1-(1-methylpyridin-1-ium-3-carbonyl)-2-[1-(1-methylpyridin-1-ium-3-carbonyl)-3-oxoindol-2-ylidene]indol-3-one.
| Compound Name | (2E)-1-(1-methylpyridin-1-ium-3-carbonyl)-2-[1-(1-methylpyridin-1-ium-3-carbonyl)-3-oxoindol-2-ylidene]indol-3-one |
|---|---|
| PubChem CID | 158800692 |
| Molecular Formula | C90H66N12O12+6 |
| Molecular Weight | 1507.59 g/mol |
| Exact Mass | 1506.49 |
| IUPAC Name | (2E)-1-(1-methylpyridin-1-ium-3-carbonyl)-2-[1-(1-methylpyridin-1-ium-3-carbonyl)-3-oxoindol-2-ylidene]indol-3-one |
| SMILES | C[n+]1cccc(C(=O)N2/C(=C3\C(=O)c4ccccc4N3C(=O)c3ccc[n+](C)c3)C(=O)c3ccccc32)c1.C[n+]1cccc(C(=O)N2/C(=C3\C(=O)c4ccccc4N3C(=O)c3ccc[n+](C)c3)C(=O)c3ccccc32)c1.C[n+]1cccc(C(=O)N2/C(=C3\C(=O)c4ccccc4N3C(=O)c3ccc[n+](C)c3)C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/3C30H22N4O4/c3*1-31-15-7-9-19(17-31)29(37)33-23-13-5-3-11-21(23)27(35)25(33)26-28(36)22-12-4-6-14-24(22)34(26)30(38)20-10-8-16-32(2)18-20/h3*3-18H,1-2H3/q3*+2/b3*26-25+ |
| InChIKey | KROJYAHBYZNHJJ-WOVKMWDYSA-N |
| XLogP | 8.80 |
| TPSA | 247.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 114 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1507.59 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_five_het_E(44)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|