C50H43NOS — CID 158801339
5,16-ditert-butyl-N,N-bis(4-phenylphenyl)-9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-11-amine (PubChem CID 158801339) has the molecular formula C50H43NOS and a molecular weight of 705.97 g/mol. Its IUPAC name is 5,16-ditert-butyl-N,N-bis(4-phenylphenyl)-9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-11-amine.
| Compound Name | 5,16-ditert-butyl-N,N-bis(4-phenylphenyl)-9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-11-amine |
|---|---|
| PubChem CID | 158801339 |
| Molecular Formula | C50H43NOS |
| Molecular Weight | 705.97 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 5,16-ditert-butyl-N,N-bis(4-phenylphenyl)-9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaen-11-amine |
| SMILES | CC(C)(C)c1ccc2sc3c(cc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)c4oc5ccc(C(C)(C)C)cc5c43)c2c1 |
| InChI | InChI=1S/C50H43NOS/c1-49(2,3)36-21-27-44-42(30-36)46-47(52-44)43(31-41-40-29-37(50(4,5)6)22-28-45(40)53-48(41)46)51(38-23-17-34(18-24-38)32-13-9-7-10-14-32)39-25-19-35(20-26-39)33-15-11-8-12-16-33/h7-31H,1-6H3 |
| InChIKey | VHUOAQKEWUHZHC-UHFFFAOYSA-N |
| XLogP | 15.35 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.97 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |