C73H58N2O — CID 146523172
3-tert-butyl-7,7-dimethyl-5-N,5-N,9-N,9-N-tetrakis(4-phenylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine (PubChem CID 146523172) has the molecular formula C73H58N2O and a molecular weight of 979.28 g/mol. Its IUPAC name is 3-tert-butyl-7,7-dimethyl-5-N,5-N,9-N,9-N-tetrakis(4-phenylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine.
| Compound Name | 3-tert-butyl-7,7-dimethyl-5-N,5-N,9-N,9-N-tetrakis(4-phenylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine |
|---|---|
| PubChem CID | 146523172 |
| Molecular Formula | C73H58N2O |
| Molecular Weight | 979.28 g/mol |
| Exact Mass | 978.45 |
| IUPAC Name | 3-tert-butyl-7,7-dimethyl-5-N,5-N,9-N,9-N-tetrakis(4-phenylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine |
| SMILES | CC(C)(C)c1ccc2oc3c4c(cc(N(c5ccc(-c6ccccc6)cc5)c5ccc(-c6ccccc6)cc5)c3c2c1)C(C)(C)c1cc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)ccc1-4 |
| InChI | InChI=1S/C73H58N2O/c1-72(2,3)57-34-45-68-64(46-57)70-67(75(60-39-30-55(31-40-60)51-22-14-8-15-23-51)61-41-32-56(33-42-61)52-24-16-9-17-25-52)48-66-69(71(70)76-68)63-44-43-62(47-65(63)73(66,4)5)74(58-35-26-53(27-36-58)49-18-10-6-11-19-49)59-37-28-54(29-38-59)50-20-12-7-13-21-50/h6-48H,1-5H3 |
| InChIKey | KJYUFCTWTQEXAH-UHFFFAOYSA-N |
| XLogP | 20.80 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.28 |
| LogP ≤ 5 | 20.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |