C20H16N2O2 — CID 15880961
7-butanoyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one (PubChem CID 15880961) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 7-butanoyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one.
| Compound Name | 7-butanoyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one |
|---|---|
| PubChem CID | 15880961 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 7-butanoyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one |
| SMILES | CCCC(=O)C1=NN=C2c3ccccc3C(=O)c3cccc(c32)C1 |
| InChI | InChI=1S/C20H16N2O2/c1-2-6-17(23)16-11-12-7-5-10-15-18(12)19(22-21-16)13-8-3-4-9-14(13)20(15)24/h3-5,7-10H,2,6,11H2,1H3 |
| InChIKey | WLQHJFUYDKZASD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|