About N-cyclohexylcyclohexanamine;hexan-1-amine
N-cyclohexylcyclohexanamine;hexan-1-amine (PubChem CID 158809778) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;hexan-1-amine.
Molecular Properties
| Compound Name | N-cyclohexylcyclohexanamine;hexan-1-amine |
| PubChem CID | 158809778 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N-cyclohexylcyclohexanamine;hexan-1-amine |
| SMILES | C1CCC(NC2CCCCC2)CC1.CCCCCCN |
| InChI | InChI=1S/C12H23N.C6H15N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7/h11-13H,1-10H2;2-7H2,1H3 |
| InChIKey | IUNMDERMRDRVJG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylcyclohexanamine;hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcyclohexanamine;hexan-1-amine?
The IUPAC name of N-cyclohexylcyclohexanamine;hexan-1-amine (CID 158809778) is N-cyclohexylcyclohexanamine;hexan-1-amine.
What is the SMILES notation for N-cyclohexylcyclohexanamine;hexan-1-amine?
The canonical SMILES for N-cyclohexylcyclohexanamine;hexan-1-amine is C1CCC(NC2CCCCC2)CC1.CCCCCCN.
What is the InChIKey of N-cyclohexylcyclohexanamine;hexan-1-amine?
The InChIKey is IUNMDERMRDRVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C6H15N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7/h11-13H,1-10H2;2-7H2,1H3.
What are the key properties of N-cyclohexylcyclohexanamine;hexan-1-amine?
N-cyclohexylcyclohexanamine;hexan-1-amine has a molecular weight of 282.52 g/mol, XLogP of 4.77, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcyclohexanamine;hexan-1-amine is sourced from PubChem (CID 158809778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).