C21H25N3O2 — CID 158813011
N-(2-methylphenyl)-4-[[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]benzamide (PubChem CID 158813011) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(2-methylphenyl)-4-[[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]benzamide.
| Compound Name | N-(2-methylphenyl)-4-[[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 158813011 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(2-methylphenyl)-4-[[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]benzamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc(N[C@@H]2CCN(C3COC3)C2)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-4-2-3-5-20(15)23-21(25)16-6-8-17(9-7-16)22-18-10-11-24(12-18)19-13-26-14-19/h2-9,18-19,22H,10-14H2,1H3,(H,23,25)/t18-/m1/s1 |
| InChIKey | IUXOJWCSJPHTFN-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |