C15H23N3OS — CID 158813750
methane;4-[(R)-(5-methyl-3-propylimidazol-4-yl)methylsulfinyl]aniline (PubChem CID 158813750) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is methane;4-[(R)-(5-methyl-3-propylimidazol-4-yl)methylsulfinyl]aniline.
| Compound Name | methane;4-[(R)-(5-methyl-3-propylimidazol-4-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 158813750 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methane;4-[(R)-(5-methyl-3-propylimidazol-4-yl)methylsulfinyl]aniline |
| SMILES | C.CCCn1cnc(C)c1C[S@@](=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H19N3OS.CH4/c1-3-8-17-10-16-11(2)14(17)9-19(18)13-6-4-12(15)5-7-13;/h4-7,10H,3,8-9,15H2,1-2H3;1H4/t19-;/m1./s1 |
| InChIKey | IUZVKBLBMCWXNQ-FSRHSHDFSA-N |
| XLogP | 3.13 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|