C33H37N3O10S — CID 131726655
(2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]aniline;hydrate (PubChem CID 131726655) has the molecular formula C33H37N3O10S and a molecular weight of 667.74 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]aniline;hydrate.
| Compound Name | (2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]aniline;hydrate |
|---|---|
| PubChem CID | 131726655 |
| Molecular Formula | C33H37N3O10S |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.22 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]aniline;hydrate |
| SMILES | CCCn1cncc1C[S@](=O)c1ccc(N)cc1.Cc1ccc(C(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1.O |
| InChI | InChI=1S/C20H18O8.C13H17N3OS.H2O/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;1-2-7-16-10-15-8-12(16)9-18(17)13-5-3-11(14)4-6-13;/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);3-6,8,10H,2,7,9,14H2,1H3;1H2/t19-,20-;18-;/m10./s1 |
| InChIKey | XGUWOSRMEHCKBR-RVXXALMLSA-N |
| XLogP | 2.36 |
| TPSA | 241.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|