C13H15FN2OS — CID 66152667
5-[(2-fluorophenyl)sulfinylmethyl]-1-propylimidazole (PubChem CID 66152667) has the molecular formula C13H15FN2OS and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)sulfinylmethyl]-1-propylimidazole.
| Compound Name | 5-[(2-fluorophenyl)sulfinylmethyl]-1-propylimidazole |
|---|---|
| PubChem CID | 66152667 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-[(2-fluorophenyl)sulfinylmethyl]-1-propylimidazole |
| SMILES | CCCn1cncc1CS(=O)c1ccccc1F |
| InChI | InChI=1S/C13H15FN2OS/c1-2-7-16-10-15-8-11(16)9-18(17)13-6-4-3-5-12(13)14/h3-6,8,10H,2,7,9H2,1H3 |
| InChIKey | MZXGASKBAZOBPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |