C13H16IN3 — CID 66135192
2-iodo-N-[(3-propylimidazol-4-yl)methyl]aniline (PubChem CID 66135192) has the molecular formula C13H16IN3 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-iodo-N-[(3-propylimidazol-4-yl)methyl]aniline.
| Compound Name | 2-iodo-N-[(3-propylimidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 66135192 |
| Molecular Formula | C13H16IN3 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-iodo-N-[(3-propylimidazol-4-yl)methyl]aniline |
| SMILES | CCCn1cncc1CNc1ccccc1I |
| InChI | InChI=1S/C13H16IN3/c1-2-7-17-10-15-8-11(17)9-16-13-6-4-3-5-12(13)14/h3-6,8,10,16H,2,7,9H2,1H3 |
| InChIKey | YETIPENOLLPACT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|