C14H18FN3 — CID 66132522
5-fluoro-2-methyl-N-[(3-propylimidazol-4-yl)methyl]aniline (PubChem CID 66132522) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-fluoro-2-methyl-N-[(3-propylimidazol-4-yl)methyl]aniline.
| Compound Name | 5-fluoro-2-methyl-N-[(3-propylimidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 66132522 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 5-fluoro-2-methyl-N-[(3-propylimidazol-4-yl)methyl]aniline |
| SMILES | CCCn1cncc1CNc1cc(F)ccc1C |
| InChI | InChI=1S/C14H18FN3/c1-3-6-18-10-16-8-13(18)9-17-14-7-12(15)5-4-11(14)2/h4-5,7-8,10,17H,3,6,9H2,1-2H3 |
| InChIKey | XKNZLBUHQJMTIR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |