C14H17F2N3S — CID 66133125
2-(difluoromethylsulfanyl)-N-[(3-propylimidazol-4-yl)methyl]aniline (PubChem CID 66133125) has the molecular formula C14H17F2N3S and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[(3-propylimidazol-4-yl)methyl]aniline.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[(3-propylimidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 66133125 |
| Molecular Formula | C14H17F2N3S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[(3-propylimidazol-4-yl)methyl]aniline |
| SMILES | CCCn1cncc1CNc1ccccc1SC(F)F |
| InChI | InChI=1S/C14H17F2N3S/c1-2-7-19-10-17-8-11(19)9-18-12-5-3-4-6-13(12)20-14(15)16/h3-6,8,10,14,18H,2,7,9H2,1H3 |
| InChIKey | ZQEIQODLWGPVEH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |