About 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate
1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate (PubChem CID 158813756) has the molecular formula C24H27Br3O8
and a molecular weight of 683.18 g/mol. Its IUPAC name is 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate.
Molecular Properties
| Compound Name | 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate |
| PubChem CID | 158813756 |
| Molecular Formula | C24H27Br3O8 |
| Molecular Weight | 683.18 g/mol |
| Exact Mass | 679.93 |
| IUPAC Name | 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate |
| SMILES | BrCc1ccc(Br)cc1.COC(=O)C(Cc1ccc(Br)cc1)C(=O)OC.COC(=O)CC(=O)OC |
| InChI | InChI=1S/C12H13BrO4.C7H6Br2.C5H8O4/c1-16-11(14)10(12(15)17-2)7-8-3-5-9(13)6-4-8;8-5-6-1-3-7(9)4-2-6;1-8-4(6)3-5(7)9-2/h3-6,10H,7H2,1-2H3;1-4H,5H2;3H2,1-2H3 |
| InChIKey | IUZVOVKHEUQJRZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 683.18 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate?
The IUPAC name of 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate (CID 158813756) is 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate.
What is the SMILES notation for 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate?
The canonical SMILES for 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate is BrCc1ccc(Br)cc1.COC(=O)C(Cc1ccc(Br)cc1)C(=O)OC.COC(=O)CC(=O)OC.
What is the InChIKey of 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate?
The InChIKey is IUZVOVKHEUQJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO4.C7H6Br2.C5H8O4/c1-16-11(14)10(12(15)17-2)7-8-3-5-9(13)6-4-8;8-5-6-1-3-7(9)4-2-6;1-8-4(6)3-5(7)9-2/h3-6,10H,7H2,1-2H3;1-4H,5H2;3H2,1-2H3.
What are the key properties of 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate?
1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate has a molecular weight of 683.18 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(bromomethyl)benzene;dimethyl 2-[(4-bromophenyl)methyl]propanedioate;dimethyl propanedioate is sourced from PubChem (CID 158813756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).