C17H23BrFNO3 — CID 158814442
(2S)-5-(4-bromo-2-fluorophenyl)-2-[(2S)-butan-2-yl]-N-(2-hydroxyethyl)-4-oxopentanamide (PubChem CID 158814442) has the molecular formula C17H23BrFNO3 and a molecular weight of 388.28 g/mol. Its IUPAC name is (2S)-5-(4-bromo-2-fluorophenyl)-2-[(2S)-butan-2-yl]-N-(2-hydroxyethyl)-4-oxopentanamide.
| Compound Name | (2S)-5-(4-bromo-2-fluorophenyl)-2-[(2S)-butan-2-yl]-N-(2-hydroxyethyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 158814442 |
| Molecular Formula | C17H23BrFNO3 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (2S)-5-(4-bromo-2-fluorophenyl)-2-[(2S)-butan-2-yl]-N-(2-hydroxyethyl)-4-oxopentanamide |
| SMILES | CC[C@H](C)[C@H](CC(=O)Cc1ccc(Br)cc1F)C(=O)NCCO |
| InChI | InChI=1S/C17H23BrFNO3/c1-3-11(2)15(17(23)20-6-7-21)10-14(22)8-12-4-5-13(18)9-16(12)19/h4-5,9,11,15,21H,3,6-8,10H2,1-2H3,(H,20,23)/t11-,15-/m0/s1 |
| InChIKey | IVCABIPKEUEOFQ-NHYWBVRUSA-N |
| XLogP | 2.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |